C16H22F2O — CID 71117377
(3,4-difluorophenyl)-[(1R,6S)-2,2,6-trimethylcyclohexyl]methanol (PubChem CID 71117377) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[(1R,6S)-2,2,6-trimethylcyclohexyl]methanol.
| Compound Name | (3,4-difluorophenyl)-[(1R,6S)-2,2,6-trimethylcyclohexyl]methanol |
|---|---|
| PubChem CID | 71117377 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3,4-difluorophenyl)-[(1R,6S)-2,2,6-trimethylcyclohexyl]methanol |
| SMILES | C[C@H]1CCCC(C)(C)[C@@H]1C(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H22F2O/c1-10-5-4-8-16(2,3)14(10)15(19)11-6-7-12(17)13(18)9-11/h6-7,9-10,14-15,19H,4-5,8H2,1-3H3/t10-,14-,15?/m0/s1 |
| InChIKey | UTNZJSOFJPMICK-BNVJPMHFSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |