C15H30O2 — CID 57000384
1-(2,2,6-trimethylcyclohexyl)hexane-1,3-diol (PubChem CID 57000384) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 1-(2,2,6-trimethylcyclohexyl)hexane-1,3-diol.
| Compound Name | 1-(2,2,6-trimethylcyclohexyl)hexane-1,3-diol |
|---|---|
| PubChem CID | 57000384 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-(2,2,6-trimethylcyclohexyl)hexane-1,3-diol |
| SMILES | CCCC(O)CC(O)C1C(C)CCCC1(C)C |
| InChI | InChI=1S/C15H30O2/c1-5-7-12(16)10-13(17)14-11(2)8-6-9-15(14,3)4/h11-14,16-17H,5-10H2,1-4H3 |
| InChIKey | OBWRNBVMFSESKV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |