C21H34O3S — CID 70302201
(1S,3S)-1-(benzenesulfonyl)-1-(2,2,6-trimethylcyclohexyl)hexan-3-ol (PubChem CID 70302201) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is (1S,3S)-1-(benzenesulfonyl)-1-(2,2,6-trimethylcyclohexyl)hexan-3-ol.
| Compound Name | (1S,3S)-1-(benzenesulfonyl)-1-(2,2,6-trimethylcyclohexyl)hexan-3-ol |
|---|---|
| PubChem CID | 70302201 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1S,3S)-1-(benzenesulfonyl)-1-(2,2,6-trimethylcyclohexyl)hexan-3-ol |
| SMILES | CCC[C@H](O)C[C@@H](C1C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H34O3S/c1-5-10-17(22)15-19(20-16(2)11-9-14-21(20,3)4)25(23,24)18-12-7-6-8-13-18/h6-8,12-13,16-17,19-20,22H,5,9-11,14-15H2,1-4H3/t16?,17-,19-,20?/m0/s1 |
| InChIKey | QAGOALDDWFGOMU-HECZYDGTSA-N |
| XLogP | 4.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |