C27H35IO5 — CID 143058470
ethane;2-(2-hydroxy-6-methylhept-5-en-2-yl)-2,3-dihydro-1-benzofuran-4-ol;(E)-3-(4-hydroxyphenyl)prop-2-enoyl iodide (PubChem CID 143058470) has the molecular formula C27H35IO5 and a molecular weight of 566.48 g/mol. Its IUPAC name is ethane;2-(2-hydroxy-6-methylhept-5-en-2-yl)-2,3-dihydro-1-benzofuran-4-ol;(E)-3-(4-hydroxyphenyl)prop-2-enoyl iodide.
| Compound Name | ethane;2-(2-hydroxy-6-methylhept-5-en-2-yl)-2,3-dihydro-1-benzofuran-4-ol;(E)-3-(4-hydroxyphenyl)prop-2-enoyl iodide |
|---|---|
| PubChem CID | 143058470 |
| Molecular Formula | C27H35IO5 |
| Molecular Weight | 566.48 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | ethane;2-(2-hydroxy-6-methylhept-5-en-2-yl)-2,3-dihydro-1-benzofuran-4-ol;(E)-3-(4-hydroxyphenyl)prop-2-enoyl iodide |
| SMILES | CC.CC(C)=CCCC(C)(O)C1Cc2c(O)cccc2O1.O=C(I)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H22O3.C9H7IO2.C2H6/c1-11(2)6-5-9-16(3,18)15-10-12-13(17)7-4-8-14(12)19-15;10-9(12)6-3-7-1-4-8(11)5-2-7;1-2/h4,6-8,15,17-18H,5,9-10H2,1-3H3;1-6,11H;1-2H3/b;6-3+; |
| InChIKey | HNVMXGYZHSSBIQ-IYVXQRGSSA-N |
| XLogP | 6.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.48 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|