C26H30O5 — CID 162928502
1-[6-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-yl]-3-[4-hydroxy-3-(4-methylpent-3-enyl)phenyl]prop-2-en-1-one (PubChem CID 162928502) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 1-[6-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-yl]-3-[4-hydroxy-3-(4-methylpent-3-enyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[6-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-yl]-3-[4-hydroxy-3-(4-methylpent-3-enyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 162928502 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-[6-hydroxy-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-yl]-3-[4-hydroxy-3-(4-methylpent-3-enyl)phenyl]prop-2-en-1-one |
| SMILES | CC(C)=CCCc1cc(C=CC(=O)c2cc3c(cc2O)OC(C(C)(C)O)C3)ccc1O |
| InChI | InChI=1S/C26H30O5/c1-16(2)6-5-7-18-12-17(8-10-21(18)27)9-11-22(28)20-13-19-14-25(26(3,4)30)31-24(19)15-23(20)29/h6,8-13,15,25,27,29-30H,5,7,14H2,1-4H3 |
| InChIKey | WPBPIIAWPDVRDS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|