C22H30O4 — CID 163142077
(2R)-7-(3,7-dimethylocta-2,6-dienyl)-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-carboxylic acid (PubChem CID 163142077) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2R)-7-(3,7-dimethylocta-2,6-dienyl)-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-carboxylic acid.
| Compound Name | (2R)-7-(3,7-dimethylocta-2,6-dienyl)-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 163142077 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2R)-7-(3,7-dimethylocta-2,6-dienyl)-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-carboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCc1cc(C(=O)O)cc2c1O[C@@H](C(C)(C)O)C2 |
| InChI | InChI=1S/C22H30O4/c1-14(2)7-6-8-15(3)9-10-16-11-18(21(23)24)12-17-13-19(22(4,5)25)26-20(16)17/h7,9,11-12,19,25H,6,8,10,13H2,1-5H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | KDOKRXUDHVXOHF-LJQANCHMSA-N |
| XLogP | 4.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|