C14H21N3 — CID 143058901
(Z)-N-[(E)-cyclohexa-2,4-dien-1-ylidene-(4-methylpiperazin-1-yl)methyl]ethanimine (PubChem CID 143058901) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (Z)-N-[(E)-cyclohexa-2,4-dien-1-ylidene-(4-methylpiperazin-1-yl)methyl]ethanimine.
| Compound Name | (Z)-N-[(E)-cyclohexa-2,4-dien-1-ylidene-(4-methylpiperazin-1-yl)methyl]ethanimine |
|---|---|
| PubChem CID | 143058901 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (Z)-N-[(E)-cyclohexa-2,4-dien-1-ylidene-(4-methylpiperazin-1-yl)methyl]ethanimine |
| SMILES | C/C=N\C(=C1\C=CC=CC1)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H21N3/c1-3-15-14(13-7-5-4-6-8-13)17-11-9-16(2)10-12-17/h3-7H,8-12H2,1-2H3/b14-13+,15-3- |
| InChIKey | TYTOQBLPBLGHEF-ILVBPBABSA-N |
| XLogP | 2.05 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|