C12H21N3 — CID 91490711
1-ethyl-4-(3-methyl-2,3-dihydropyridin-2-yl)piperazine (PubChem CID 91490711) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-ethyl-4-(3-methyl-2,3-dihydropyridin-2-yl)piperazine.
| Compound Name | 1-ethyl-4-(3-methyl-2,3-dihydropyridin-2-yl)piperazine |
|---|---|
| PubChem CID | 91490711 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 1-ethyl-4-(3-methyl-2,3-dihydropyridin-2-yl)piperazine |
| SMILES | CCN1CCN(C2N=CC=CC2C)CC1 |
| InChI | InChI=1S/C12H21N3/c1-3-14-7-9-15(10-8-14)12-11(2)5-4-6-13-12/h4-6,11-12H,3,7-10H2,1-2H3 |
| InChIKey | AQWTYHVDRPOGIA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |