C10H17N3 — CID 146890252
1-(3-methyl-2,3-dihydropyridin-2-yl)piperazine (PubChem CID 146890252) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(3-methyl-2,3-dihydropyridin-2-yl)piperazine.
| Compound Name | 1-(3-methyl-2,3-dihydropyridin-2-yl)piperazine |
|---|---|
| PubChem CID | 146890252 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(3-methyl-2,3-dihydropyridin-2-yl)piperazine |
| SMILES | CC1C=CC=NC1N1CCNCC1 |
| InChI | InChI=1S/C10H17N3/c1-9-3-2-4-12-10(9)13-7-5-11-6-8-13/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | SZBGGHCLBAERRB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |