C15H27N3 — CID 144745251
(Z,Z)-N-[(E)-1-(3,3-dimethylpiperazin-1-yl)-2-methylbut-1-enyl]but-2-en-1-imine (PubChem CID 144745251) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (Z,Z)-N-[(E)-1-(3,3-dimethylpiperazin-1-yl)-2-methylbut-1-enyl]but-2-en-1-imine.
| Compound Name | (Z,Z)-N-[(E)-1-(3,3-dimethylpiperazin-1-yl)-2-methylbut-1-enyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 144745251 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (Z,Z)-N-[(E)-1-(3,3-dimethylpiperazin-1-yl)-2-methylbut-1-enyl]but-2-en-1-imine |
| SMILES | C/C=C\C=N/C(=C(\C)CC)N1CCNC(C)(C)C1 |
| InChI | InChI=1S/C15H27N3/c1-6-8-9-16-14(13(3)7-2)18-11-10-17-15(4,5)12-18/h6,8-9,17H,7,10-12H2,1-5H3/b8-6-,14-13-,16-9- |
| InChIKey | AFCNWDWAYFEIAA-WNYFRGLJSA-N |
| XLogP | 2.96 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|