About (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine
(4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine (PubChem CID 143566763) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine.
Molecular Properties
| Compound Name | (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine |
| PubChem CID | 143566763 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine |
| SMILES | CC1=C(N2CCNCC2)N=CC=C[C@H]1C |
| InChI | InChI=1S/C12H19N3/c1-10-4-3-5-14-12(11(10)2)15-8-6-13-7-9-15/h3-5,10,13H,6-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | SNGALRRAVKRABJ-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine?
The IUPAC name of (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine (CID 143566763) is (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine.
What is the SMILES notation for (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine?
The canonical SMILES for (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine is CC1=C(N2CCNCC2)N=CC=C[C@H]1C.
What is the InChIKey of (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine?
The InChIKey is SNGALRRAVKRABJ-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H19N3/c1-10-4-3-5-14-12(11(10)2)15-8-6-13-7-9-15/h3-5,10,13H,6-9H2,1-2H3/t10-/m1/s1.
What are the key properties of (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine?
(4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine has a molecular weight of 205.31 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3,4-dimethyl-2-piperazin-1-yl-4H-azepine is sourced from PubChem (CID 143566763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).