About 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine
2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine (PubChem CID 91094637) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine.
Analyze 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine?
The IUPAC name of 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine (CID 91094637) is 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine.
What is the SMILES notation for 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine?
The canonical SMILES for 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine is C1=CC2C=NCCNC2N=C1.
What is the InChIKey of 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine?
The InChIKey is XYBRQFYKTAJJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-2-7-6-9-4-5-11-8(7)10-3-1/h1-3,6-8,11H,4-5H2.
What are the key properties of 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine?
2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine has a molecular weight of 149.20 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5a,9a-tetrahydro-1H-pyrido[2,3-e][1,4]diazepine is sourced from PubChem (CID 91094637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).