C10H17N3 — CID 91076121
1-(2,5-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium (PubChem CID 91076121) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(2,5-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium.
| Compound Name | 1-(2,5-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium |
|---|---|
| PubChem CID | 91076121 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(2,5-dihydropyridin-2-yl)-4-methanidylpiperazin-4-ium |
| SMILES | [CH2-][NH+]1CCN(C2C=CCC=N2)CC1 |
| InChI | InChI=1S/C10H17N3/c1-12-6-8-13(9-7-12)10-4-2-3-5-11-10/h2,4-5,10,12H,1,3,6-9H2 |
| InChIKey | DNSBTKXIFWFXJS-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|