About 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne
5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne (PubChem CID 143058914) has the molecular formula C15H24N4
and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne.
Molecular Properties
| Compound Name | 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne |
| PubChem CID | 143058914 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne |
| SMILES | C#CC.C=CC1=C(N2CCN(C)CC2)NC=NC1C |
| InChI | InChI=1S/C12H20N4.C3H4/c1-4-11-10(2)13-9-14-12(11)16-7-5-15(3)6-8-16;1-3-2/h4,9-10H,1,5-8H2,2-3H3,(H,13,14);1H,2H3 |
| InChIKey | RPSDHENLYNJCRY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne?
The IUPAC name of 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne (CID 143058914) is 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne.
What is the SMILES notation for 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne?
The canonical SMILES for 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne is C#CC.C=CC1=C(N2CCN(C)CC2)NC=NC1C.
What is the InChIKey of 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne?
The InChIKey is RPSDHENLYNJCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4.C3H4/c1-4-11-10(2)13-9-14-12(11)16-7-5-15(3)6-8-16;1-3-2/h4,9-10H,1,5-8H2,2-3H3,(H,13,14);1H,2H3.
What are the key properties of 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne?
5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne has a molecular weight of 260.38 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4-methyl-6-(4-methylpiperazin-1-yl)-1,4-dihydropyrimidine;prop-1-yne is sourced from PubChem (CID 143058914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).