C11H20N4 — CID 144696996
6-(4-ethylpiperazin-1-yl)-4-methyl-1,4-dihydropyrimidine (PubChem CID 144696996) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 6-(4-ethylpiperazin-1-yl)-4-methyl-1,4-dihydropyrimidine.
| Compound Name | 6-(4-ethylpiperazin-1-yl)-4-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 144696996 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 6-(4-ethylpiperazin-1-yl)-4-methyl-1,4-dihydropyrimidine |
| SMILES | CCN1CCN(C2=CC(C)N=CN2)CC1 |
| InChI | InChI=1S/C11H20N4/c1-3-14-4-6-15(7-5-14)11-8-10(2)12-9-13-11/h8-10H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | GKVHKBKQZMNXIJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |