C10H18N4 — CID 139986213
4,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine (PubChem CID 139986213) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 4,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine.
| Compound Name | 4,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine |
|---|---|
| PubChem CID | 139986213 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine |
| SMILES | CC1(C)C=CNC(N2CCNCC2)=N1 |
| InChI | InChI=1S/C10H18N4/c1-10(2)3-4-12-9(13-10)14-7-5-11-6-8-14/h3-4,11H,5-8H2,1-2H3,(H,12,13) |
| InChIKey | HGVCNYJWGFTMSR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |