C11H22N6 — CID 151379503
6-piperazin-1-yl-4-propan-2-yl-1H-pyrimidine-2,4-diamine (PubChem CID 151379503) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is 6-piperazin-1-yl-4-propan-2-yl-1H-pyrimidine-2,4-diamine.
| Compound Name | 6-piperazin-1-yl-4-propan-2-yl-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 151379503 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 6-piperazin-1-yl-4-propan-2-yl-1H-pyrimidine-2,4-diamine |
| SMILES | CC(C)C1(N)C=C(N2CCNCC2)NC(N)=N1 |
| InChI | InChI=1S/C11H22N6/c1-8(2)11(13)7-9(15-10(12)16-11)17-5-3-14-4-6-17/h7-8,14H,3-6,13H2,1-2H3,(H3,12,15,16) |
| InChIKey | OSCOOZXGQIBJNV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 91.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |