C10H20N6 — CID 150184202
4-N,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine-4,6-diamine (PubChem CID 150184202) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-N,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 150184202 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 4-N,4-dimethyl-2-piperazin-1-yl-1H-pyrimidine-4,6-diamine |
| SMILES | CNC1(C)C=C(N)NC(N2CCNCC2)=N1 |
| InChI | InChI=1S/C10H20N6/c1-10(12-2)7-8(11)14-9(15-10)16-5-3-13-4-6-16/h7,12-13H,3-6,11H2,1-2H3,(H,14,15) |
| InChIKey | FMBGSQAYLBJRGJ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |