C11H20N4 — CID 144745253
2,2-dimethyl-N-methylidene-N'-[(Z)-prop-1-enyl]piperazine-1-carboximidamide (PubChem CID 144745253) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-methylidene-N'-[(Z)-prop-1-enyl]piperazine-1-carboximidamide.
| Compound Name | 2,2-dimethyl-N-methylidene-N'-[(Z)-prop-1-enyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 144745253 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2,2-dimethyl-N-methylidene-N'-[(Z)-prop-1-enyl]piperazine-1-carboximidamide |
| SMILES | C=N/C(=N\C=C/C)N1CCNCC1(C)C |
| InChI | InChI=1S/C11H20N4/c1-5-6-14-10(12-4)15-8-7-13-9-11(15,2)3/h5-6,13H,4,7-9H2,1-3H3/b6-5-,14-10+ |
| InChIKey | SZGCFOTUFOKWBB-WULNTPNUSA-N |
| XLogP | 1.26 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|