C22H20N4O6 — CID 143062051
4-[4-[[(2,4-dihydroxybenzoyl)amino]carbamoyl]phenoxy]-N-ethylpyridine-2-carboxamide (PubChem CID 143062051) has the molecular formula C22H20N4O6 and a molecular weight of 436.42 g/mol. Its IUPAC name is 4-[4-[[(2,4-dihydroxybenzoyl)amino]carbamoyl]phenoxy]-N-ethylpyridine-2-carboxamide.
| Compound Name | 4-[4-[[(2,4-dihydroxybenzoyl)amino]carbamoyl]phenoxy]-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143062051 |
| Molecular Formula | C22H20N4O6 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-[4-[[(2,4-dihydroxybenzoyl)amino]carbamoyl]phenoxy]-N-ethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(Oc2ccc(C(=O)NNC(=O)c3ccc(O)cc3O)cc2)ccn1 |
| InChI | InChI=1S/C22H20N4O6/c1-2-23-22(31)18-12-16(9-10-24-18)32-15-6-3-13(4-7-15)20(29)25-26-21(30)17-8-5-14(27)11-19(17)28/h3-12,27-28H,2H2,1H3,(H,23,31)(H,25,29)(H,26,30) |
| InChIKey | NCKDHKURJTYCQM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|