C15H21N7O2 — CID 143062943
2-[methyl-[[4-[1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]ethenyldiazenyl]phenyl]diazenyl]amino]acetic acid (PubChem CID 143062943) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[methyl-[[4-[1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]ethenyldiazenyl]phenyl]diazenyl]amino]acetic acid.
| Compound Name | 2-[methyl-[[4-[1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]ethenyldiazenyl]phenyl]diazenyl]amino]acetic acid |
|---|---|
| PubChem CID | 143062943 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[methyl-[[4-[1-[methyl-[(Z)-2-(methylamino)ethenyl]amino]ethenyldiazenyl]phenyl]diazenyl]amino]acetic acid |
| SMILES | C=C(/N=N/c1ccc(/N=N/N(C)CC(=O)O)cc1)N(C)/C=C\NC |
| InChI | InChI=1S/C15H21N7O2/c1-12(21(3)10-9-16-2)17-18-13-5-7-14(8-6-13)19-20-22(4)11-15(23)24/h5-10,16H,1,11H2,2-4H3,(H,23,24)/b10-9-,18-17+,20-19+ |
| InChIKey | SCIOSOTWYHGNCK-ZQIPUMJHSA-N |
| XLogP | 2.88 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|