C29H49NO2 — CID 143063947
butane;2,2-dimethyl-1-[3-pentyl-4-(phenylmethoxymethyl)-4H-pyridin-1-yl]propan-1-one;ethane (PubChem CID 143063947) has the molecular formula C29H49NO2 and a molecular weight of 443.72 g/mol. Its IUPAC name is butane;2,2-dimethyl-1-[3-pentyl-4-(phenylmethoxymethyl)-4H-pyridin-1-yl]propan-1-one;ethane.
| Compound Name | butane;2,2-dimethyl-1-[3-pentyl-4-(phenylmethoxymethyl)-4H-pyridin-1-yl]propan-1-one;ethane |
|---|---|
| PubChem CID | 143063947 |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.38 |
| IUPAC Name | butane;2,2-dimethyl-1-[3-pentyl-4-(phenylmethoxymethyl)-4H-pyridin-1-yl]propan-1-one;ethane |
| SMILES | CC.CCCC.CCCCCC1=CN(C(=O)C(C)(C)C)C=CC1COCc1ccccc1 |
| InChI | InChI=1S/C23H33NO2.C4H10.C2H6/c1-5-6-8-13-20-16-24(22(25)23(2,3)4)15-14-21(20)18-26-17-19-11-9-7-10-12-19;1-3-4-2;1-2/h7,9-12,14-16,21H,5-6,8,13,17-18H2,1-4H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | TYDYISZJEOVVMG-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|