C21H42N2 — CID 143064826
4,4-dibutyl-2-methylidene-1-(3-propylhexyl)imidazolidine (PubChem CID 143064826) has the molecular formula C21H42N2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 4,4-dibutyl-2-methylidene-1-(3-propylhexyl)imidazolidine.
| Compound Name | 4,4-dibutyl-2-methylidene-1-(3-propylhexyl)imidazolidine |
|---|---|
| PubChem CID | 143064826 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | 4,4-dibutyl-2-methylidene-1-(3-propylhexyl)imidazolidine |
| SMILES | C=C1NC(CCCC)(CCCC)CN1CCC(CCC)CCC |
| InChI | InChI=1S/C21H42N2/c1-6-10-15-21(16-11-7-2)18-23(19(5)22-21)17-14-20(12-8-3)13-9-4/h20,22H,5-18H2,1-4H3 |
| InChIKey | GUDFQYACOFFLHN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |