C26H34N2O2 — CID 143066051
(4S)-2-tert-butyl-4-[2-[6-[(4S)-2-tert-butyl-4,5-dihydro-1,3-oxazol-4-yl]cyclohexa-1,3-dien-1-yl]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 143066051) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (4S)-2-tert-butyl-4-[2-[6-[(4S)-2-tert-butyl-4,5-dihydro-1,3-oxazol-4-yl]cyclohexa-1,3-dien-1-yl]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-tert-butyl-4-[2-[6-[(4S)-2-tert-butyl-4,5-dihydro-1,3-oxazol-4-yl]cyclohexa-1,3-dien-1-yl]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 143066051 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (4S)-2-tert-butyl-4-[2-[6-[(4S)-2-tert-butyl-4,5-dihydro-1,3-oxazol-4-yl]cyclohexa-1,3-dien-1-yl]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)C1=N[C@@H](c2ccccc2C2=CC=CCC2[C@H]2COC(C(C)(C)C)=N2)CO1 |
| InChI | InChI=1S/C26H34N2O2/c1-25(2,3)23-27-21(15-29-23)19-13-9-7-11-17(19)18-12-8-10-14-20(18)22-16-30-24(28-22)26(4,5)6/h7-13,20-22H,14-16H2,1-6H3/t20?,21-,22-/m1/s1 |
| InChIKey | MDWACKGNEKRAGQ-HRUVVLKGSA-N |
| XLogP | 6.01 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |