C26H36N2O2 — CID 14306726
2-[[1-[3-(4-methoxyphenoxy)propyl]pyrrolidin-3-yl]methyl]-6,7-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 14306726) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-[[1-[3-(4-methoxyphenoxy)propyl]pyrrolidin-3-yl]methyl]-6,7-dimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[[1-[3-(4-methoxyphenoxy)propyl]pyrrolidin-3-yl]methyl]-6,7-dimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 14306726 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 2-[[1-[3-(4-methoxyphenoxy)propyl]pyrrolidin-3-yl]methyl]-6,7-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(OCCCN2CCC(CN3CCc4cc(C)c(C)cc4C3)C2)cc1 |
| InChI | InChI=1S/C26H36N2O2/c1-20-15-23-10-13-28(19-24(23)16-21(20)2)18-22-9-12-27(17-22)11-4-14-30-26-7-5-25(29-3)6-8-26/h5-8,15-16,22H,4,9-14,17-19H2,1-3H3 |
| InChIKey | BXQIMEAPCGFLDH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|