C25H37NO3 — CID 143067899
ethane;4-ethyl-3-[2-(2-methoxy-4-propanoylphenyl)ethyl]benzamide (PubChem CID 143067899) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is ethane;4-ethyl-3-[2-(2-methoxy-4-propanoylphenyl)ethyl]benzamide.
| Compound Name | ethane;4-ethyl-3-[2-(2-methoxy-4-propanoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 143067899 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | ethane;4-ethyl-3-[2-(2-methoxy-4-propanoylphenyl)ethyl]benzamide |
| SMILES | CC.CC.CCC(=O)c1ccc(CCc2cc(C(N)=O)ccc2CC)c(OC)c1 |
| InChI | InChI=1S/C21H25NO3.2C2H6/c1-4-14-6-11-18(21(22)24)12-16(14)9-7-15-8-10-17(19(23)5-2)13-20(15)25-3;2*1-2/h6,8,10-13H,4-5,7,9H2,1-3H3,(H2,22,24);2*1-2H3 |
| InChIKey | AFJJBALHKHFMJT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |