C22H30N2O3 — CID 143067890
3-ethylbenzamide;4-ethyl-3-methoxybenzamide;prop-1-ene (PubChem CID 143067890) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 3-ethylbenzamide;4-ethyl-3-methoxybenzamide;prop-1-ene.
| Compound Name | 3-ethylbenzamide;4-ethyl-3-methoxybenzamide;prop-1-ene |
|---|---|
| PubChem CID | 143067890 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-ethylbenzamide;4-ethyl-3-methoxybenzamide;prop-1-ene |
| SMILES | C=CC.CCc1ccc(C(N)=O)cc1OC.CCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C10H13NO2.C9H11NO.C3H6/c1-3-7-4-5-8(10(11)12)6-9(7)13-2;1-2-7-4-3-5-8(6-7)9(10)11;1-3-2/h4-6H,3H2,1-2H3,(H2,11,12);3-6H,2H2,1H3,(H2,10,11);3H,1H2,2H3 |
| InChIKey | YAIDRMKNRJHNCB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|