C19H25Cl2N5O3 — CID 86672754
3-(2-amino-2-iminoethyl)benzamide;methyl 3-(2-amino-2-iminoethyl)benzoate;dihydrochloride (PubChem CID 86672754) has the molecular formula C19H25Cl2N5O3 and a molecular weight of 442.35 g/mol. Its IUPAC name is 3-(2-amino-2-iminoethyl)benzamide;methyl 3-(2-amino-2-iminoethyl)benzoate;dihydrochloride.
| Compound Name | 3-(2-amino-2-iminoethyl)benzamide;methyl 3-(2-amino-2-iminoethyl)benzoate;dihydrochloride |
|---|---|
| PubChem CID | 86672754 |
| Molecular Formula | C19H25Cl2N5O3 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-(2-amino-2-iminoethyl)benzamide;methyl 3-(2-amino-2-iminoethyl)benzoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)Cc1cccc(C(=O)OC)c1.[H]/N=C(\N)Cc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C10H12N2O2.C9H11N3O.2ClH/c1-14-10(13)8-4-2-3-7(5-8)6-9(11)12;10-8(11)5-6-2-1-3-7(4-6)9(12)13;;/h2-5H,6H2,1H3,(H3,11,12);1-4H,5H2,(H3,10,11)(H2,12,13);2*1H |
| InChIKey | PGYKOLIDJGADCR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|