C18H26FNO2 — CID 143068489
2-[1-cyclopentyl-2-(5-fluoro-2-methoxyphenyl)ethyl]morpholine (PubChem CID 143068489) has the molecular formula C18H26FNO2 and a molecular weight of 307.41 g/mol. Its IUPAC name is 2-[1-cyclopentyl-2-(5-fluoro-2-methoxyphenyl)ethyl]morpholine.
| Compound Name | 2-[1-cyclopentyl-2-(5-fluoro-2-methoxyphenyl)ethyl]morpholine |
|---|---|
| PubChem CID | 143068489 |
| Molecular Formula | C18H26FNO2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-[1-cyclopentyl-2-(5-fluoro-2-methoxyphenyl)ethyl]morpholine |
| SMILES | COc1ccc(F)cc1CC(C1CCCC1)C1CNCCO1 |
| InChI | InChI=1S/C18H26FNO2/c1-21-17-7-6-15(19)10-14(17)11-16(13-4-2-3-5-13)18-12-20-8-9-22-18/h6-7,10,13,16,18,20H,2-5,8-9,11-12H2,1H3 |
| InChIKey | HQNSWHNCOXAIIT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |