C14H17F2NO2 — CID 59166841
(2S)-2-[cyclopropyl-(2,4-difluorophenoxy)methyl]morpholine (PubChem CID 59166841) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is (2S)-2-[cyclopropyl-(2,4-difluorophenoxy)methyl]morpholine.
| Compound Name | (2S)-2-[cyclopropyl-(2,4-difluorophenoxy)methyl]morpholine |
|---|---|
| PubChem CID | 59166841 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (2S)-2-[cyclopropyl-(2,4-difluorophenoxy)methyl]morpholine |
| SMILES | Fc1ccc(OC(C2CC2)[C@@H]2CNCCO2)c(F)c1 |
| InChI | InChI=1S/C14H17F2NO2/c15-10-3-4-12(11(16)7-10)19-14(9-1-2-9)13-8-17-5-6-18-13/h3-4,7,9,13-14,17H,1-2,5-6,8H2/t13-,14?/m0/s1 |
| InChIKey | SKJDAQXQHQZGMT-LSLKUGRBSA-N |
| XLogP | 2.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |