C16H16F2N2O2 — CID 11594682
2-[(2,4-difluorophenoxy)-pyridin-2-ylmethyl]morpholine (PubChem CID 11594682) has the molecular formula C16H16F2N2O2 and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-[(2,4-difluorophenoxy)-pyridin-2-ylmethyl]morpholine.
| Compound Name | 2-[(2,4-difluorophenoxy)-pyridin-2-ylmethyl]morpholine |
|---|---|
| PubChem CID | 11594682 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[(2,4-difluorophenoxy)-pyridin-2-ylmethyl]morpholine |
| SMILES | Fc1ccc(OC(c2ccccn2)C2CNCCO2)c(F)c1 |
| InChI | InChI=1S/C16H16F2N2O2/c17-11-4-5-14(12(18)9-11)22-16(13-3-1-2-6-20-13)15-10-19-7-8-21-15/h1-6,9,15-16,19H,7-8,10H2 |
| InChIKey | FDKOWWGJOIWTIA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |