C21H18F3N3O3S — CID 143069319
2-[3-(aminomethylideneamino)-5-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]methylsulfanyl]phenyl]acetic acid (PubChem CID 143069319) has the molecular formula C21H18F3N3O3S and a molecular weight of 449.45 g/mol. Its IUPAC name is 2-[3-(aminomethylideneamino)-5-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]methylsulfanyl]phenyl]acetic acid.
| Compound Name | 2-[3-(aminomethylideneamino)-5-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]methylsulfanyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 143069319 |
| Molecular Formula | C21H18F3N3O3S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-[3-(aminomethylideneamino)-5-[[4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]methylsulfanyl]phenyl]acetic acid |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)oc1CSc1cc(CC(=O)O)cc(/N=C/N)c1 |
| InChI | InChI=1S/C21H18F3N3O3S/c1-12-18(30-20(27-12)14-2-4-15(5-3-14)21(22,23)24)10-31-17-7-13(8-19(28)29)6-16(9-17)26-11-25/h2-7,9,11H,8,10H2,1H3,(H2,25,26)(H,28,29) |
| InChIKey | CBZACRFDWNMUSH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|