C13H11BrF3NO — CID 174698840
5-(2-bromoethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 174698840) has the molecular formula C13H11BrF3NO and a molecular weight of 334.14 g/mol. Its IUPAC name is 5-(2-bromoethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 5-(2-bromoethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 174698840 |
| Molecular Formula | C13H11BrF3NO |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 5-(2-bromoethyl)-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)oc1CCBr |
| InChI | InChI=1S/C13H11BrF3NO/c1-8-11(6-7-14)19-12(18-8)9-2-4-10(5-3-9)13(15,16)17/h2-5H,6-7H2,1H3 |
| InChIKey | MVOBPEPENPPVOS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|