C19H15ClF3NO2 — CID 69172323
5-[[3-(chloromethyl)phenoxy]methyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole (PubChem CID 69172323) has the molecular formula C19H15ClF3NO2 and a molecular weight of 381.78 g/mol. Its IUPAC name is 5-[[3-(chloromethyl)phenoxy]methyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole.
| Compound Name | 5-[[3-(chloromethyl)phenoxy]methyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 69172323 |
| Molecular Formula | C19H15ClF3NO2 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 5-[[3-(chloromethyl)phenoxy]methyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazole |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)oc1COc1cccc(CCl)c1 |
| InChI | InChI=1S/C19H15ClF3NO2/c1-12-17(11-25-16-4-2-3-13(9-16)10-20)26-18(24-12)14-5-7-15(8-6-14)19(21,22)23/h2-9H,10-11H2,1H3 |
| InChIKey | KWMVRLNMTMPMOS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|