C28H29N3O — CID 143069836
5-ethyl-1,3-diphenyl-N-(2-phenylbutan-2-yl)pyrazole-4-carboxamide (PubChem CID 143069836) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-ethyl-1,3-diphenyl-N-(2-phenylbutan-2-yl)pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-1,3-diphenyl-N-(2-phenylbutan-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 143069836 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 5-ethyl-1,3-diphenyl-N-(2-phenylbutan-2-yl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NC(C)(CC)c2ccccc2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C28H29N3O/c1-4-24-25(27(32)29-28(3,5-2)22-17-11-7-12-18-22)26(21-15-9-6-10-16-21)30-31(24)23-19-13-8-14-20-23/h6-20H,4-5H2,1-3H3,(H,29,32) |
| InChIKey | SAHLWADDBOHDIU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |