C20H20F3NO2 — CID 143070128
5-[(5R)-9-(1,1-difluoroethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol (PubChem CID 143070128) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 5-[(5R)-9-(1,1-difluoroethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol.
| Compound Name | 5-[(5R)-9-(1,1-difluoroethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 143070128 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 5-[(5R)-9-(1,1-difluoroethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]-2-fluorophenol |
| SMILES | CC(F)(F)c1ccc2c(c1)C1OCCCC1[C@H](c1ccc(F)c(O)c1)N2 |
| InChI | InChI=1S/C20H20F3NO2/c1-20(22,23)12-5-7-16-14(10-12)19-13(3-2-8-26-19)18(24-16)11-4-6-15(21)17(25)9-11/h4-7,9-10,13,18-19,24-25H,2-3,8H2,1H3/t13?,18-,19?/m0/s1 |
| InChIKey | AEWXJXOERHCHJF-SZSCYUJKSA-N |
| XLogP | 5.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |