C25H32FNO4S — CID 143070345
methylcyclohexane;methyl 5-(4-fluorophenyl)-2-[formyl(oxan-4-yl)amino]thiophene-3-carboxylate (PubChem CID 143070345) has the molecular formula C25H32FNO4S and a molecular weight of 461.60 g/mol. Its IUPAC name is methylcyclohexane;methyl 5-(4-fluorophenyl)-2-[formyl(oxan-4-yl)amino]thiophene-3-carboxylate.
| Compound Name | methylcyclohexane;methyl 5-(4-fluorophenyl)-2-[formyl(oxan-4-yl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 143070345 |
| Molecular Formula | C25H32FNO4S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | methylcyclohexane;methyl 5-(4-fluorophenyl)-2-[formyl(oxan-4-yl)amino]thiophene-3-carboxylate |
| SMILES | CC1CCCCC1.COC(=O)c1cc(-c2ccc(F)cc2)sc1N(C=O)C1CCOCC1 |
| InChI | InChI=1S/C18H18FNO4S.C7H14/c1-23-18(22)15-10-16(12-2-4-13(19)5-3-12)25-17(15)20(11-21)14-6-8-24-9-7-14;1-7-5-3-2-4-6-7/h2-5,10-11,14H,6-9H2,1H3;7H,2-6H2,1H3 |
| InChIKey | PDHKSRXWNYOOGQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|