C11H19N — CID 143070430
3,6-dimethyl-1-propyl-1-azacyclohept-4-yne (PubChem CID 143070430) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 3,6-dimethyl-1-propyl-1-azacyclohept-4-yne.
| Compound Name | 3,6-dimethyl-1-propyl-1-azacyclohept-4-yne |
|---|---|
| PubChem CID | 143070430 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3,6-dimethyl-1-propyl-1-azacyclohept-4-yne |
| SMILES | CCCN1CC(C)C#CC(C)C1 |
| InChI | InChI=1S/C11H19N/c1-4-7-12-8-10(2)5-6-11(3)9-12/h10-11H,4,7-9H2,1-3H3 |
| InChIKey | JTEQEJDGJYPCRX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|