C9H19N — CID 59055005
(3S,4S)-3,4-dimethyl-1-propylpyrrolidine (PubChem CID 59055005) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethyl-1-propylpyrrolidine.
| Compound Name | (3S,4S)-3,4-dimethyl-1-propylpyrrolidine |
|---|---|
| PubChem CID | 59055005 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (3S,4S)-3,4-dimethyl-1-propylpyrrolidine |
| SMILES | CCCN1C[C@@H](C)[C@H](C)C1 |
| InChI | InChI=1S/C9H19N/c1-4-5-10-6-8(2)9(3)7-10/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | KMRXKQNYPMVNSR-RKDXNWHRSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |