About (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene
(2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene (PubChem CID 143074049) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene.
Molecular Properties
| Compound Name | (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene |
| PubChem CID | 143074049 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene |
| SMILES | CO/C(C)=C(/CC=C(C)C)OC |
| InChI | InChI=1S/C10H18O2/c1-8(2)6-7-10(12-5)9(3)11-4/h6H,7H2,1-5H3/b10-9- |
| InChIKey | HDOXFHBLIADOTC-KTKRTIGZSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene?
The IUPAC name of (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene (CID 143074049) is (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene.
What is the SMILES notation for (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene?
The canonical SMILES for (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene is CO/C(C)=C(/CC=C(C)C)OC.
What is the InChIKey of (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene?
The InChIKey is HDOXFHBLIADOTC-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H18O2/c1-8(2)6-7-10(12-5)9(3)11-4/h6H,7H2,1-5H3/b10-9-.
What are the key properties of (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene?
(2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene has a molecular weight of 170.25 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2,3-dimethoxy-6-methylhepta-2,5-diene is sourced from PubChem (CID 143074049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).