About methanolate;3-methylbut-2-enyltin(3+)
methanolate;3-methylbut-2-enyltin(3+) (PubChem CID 174192020) has the molecular formula C8H18O3Sn
and a molecular weight of 280.94 g/mol. Its IUPAC name is methanolate;3-methylbut-2-enyltin(3+).
Molecular Properties
| Compound Name | methanolate;3-methylbut-2-enyltin(3+) |
| PubChem CID | 174192020 |
| Molecular Formula | C8H18O3Sn |
| Molecular Weight | 280.94 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | methanolate;3-methylbut-2-enyltin(3+) |
| SMILES | CC(C)=CC[Sn+3].C[O-].C[O-].C[O-] |
| InChI | InChI=1S/C5H9.3CH3O.Sn/c1-4-5(2)3;3*1-2;/h4H,1H2,2-3H3;3*1H3;/q;3*-1;+3 |
| InChIKey | NNZMACZEGPAIEB-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.94 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanolate;3-methylbut-2-enyltin(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanolate;3-methylbut-2-enyltin(3+)?
The IUPAC name of methanolate;3-methylbut-2-enyltin(3+) (CID 174192020) is methanolate;3-methylbut-2-enyltin(3+).
What is the SMILES notation for methanolate;3-methylbut-2-enyltin(3+)?
The canonical SMILES for methanolate;3-methylbut-2-enyltin(3+) is CC(C)=CC[Sn+3].C[O-].C[O-].C[O-].
What is the InChIKey of methanolate;3-methylbut-2-enyltin(3+)?
The InChIKey is NNZMACZEGPAIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9.3CH3O.Sn/c1-4-5(2)3;3*1-2;/h4H,1H2,2-3H3;3*1H3;/q;3*-1;+3.
What are the key properties of methanolate;3-methylbut-2-enyltin(3+)?
methanolate;3-methylbut-2-enyltin(3+) has a molecular weight of 280.94 g/mol, XLogP of -1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanolate;3-methylbut-2-enyltin(3+) is sourced from PubChem (CID 174192020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).