C13H16O3 — CID 143075353
ethyl (1S,1aR,7bR)-1,1a,2,3a,7a,7b-hexahydrocyclopropa[c]chromene-1-carboxylate (PubChem CID 143075353) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl (1S,1aR,7bR)-1,1a,2,3a,7a,7b-hexahydrocyclopropa[c]chromene-1-carboxylate.
| Compound Name | ethyl (1S,1aR,7bR)-1,1a,2,3a,7a,7b-hexahydrocyclopropa[c]chromene-1-carboxylate |
|---|---|
| PubChem CID | 143075353 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | ethyl (1S,1aR,7bR)-1,1a,2,3a,7a,7b-hexahydrocyclopropa[c]chromene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2COC3C=CC=CC3[C@@H]21 |
| InChI | InChI=1S/C13H16O3/c1-2-15-13(14)12-9-7-16-10-6-4-3-5-8(10)11(9)12/h3-6,8-12H,2,7H2,1H3/t8?,9-,10?,11+,12-/m1/s1 |
| InChIKey | BSFVMQANKGPEBQ-MNRJGNLVSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |