C13H18O5 — CID 134897786
methyl (2'S,5'R)-5'-methoxyspiro[1,3-dioxane-2,7'-bicyclo[4.1.0]hept-3-ene]-2'-carboxylate (PubChem CID 134897786) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl (2'S,5'R)-5'-methoxyspiro[1,3-dioxane-2,7'-bicyclo[4.1.0]hept-3-ene]-2'-carboxylate.
| Compound Name | methyl (2'S,5'R)-5'-methoxyspiro[1,3-dioxane-2,7'-bicyclo[4.1.0]hept-3-ene]-2'-carboxylate |
|---|---|
| PubChem CID | 134897786 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methyl (2'S,5'R)-5'-methoxyspiro[1,3-dioxane-2,7'-bicyclo[4.1.0]hept-3-ene]-2'-carboxylate |
| SMILES | COC(=O)[C@H]1C=C[C@@H](OC)C2C1C21OCCCO1 |
| InChI | InChI=1S/C13H18O5/c1-15-9-5-4-8(12(14)16-2)10-11(9)13(10)17-6-3-7-18-13/h4-5,8-11H,3,6-7H2,1-2H3/t8-,9+,10?,11?/m0/s1 |
| InChIKey | VRFQEBPLEIYHNP-IZUQBHJASA-N |
| XLogP | 0.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|