C13H18O4 — CID 14714181
ethyl (3aR,5aR,6R,6aS,6bS)-2,2-dimethyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole-6-carboxylate (PubChem CID 14714181) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is ethyl (3aR,5aR,6R,6aS,6bS)-2,2-dimethyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole-6-carboxylate.
| Compound Name | ethyl (3aR,5aR,6R,6aS,6bS)-2,2-dimethyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 14714181 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | ethyl (3aR,5aR,6R,6aS,6bS)-2,2-dimethyl-5a,6,6a,6b-tetrahydro-3aH-cyclopropa[g][1,3]benzodioxole-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C=C[C@H]3OC(C)(C)O[C@H]3[C@@H]21 |
| InChI | InChI=1S/C13H18O4/c1-4-15-12(14)10-7-5-6-8-11(9(7)10)17-13(2,3)16-8/h5-11H,4H2,1-3H3/t7-,8-,9+,10-,11-/m1/s1 |
| InChIKey | DEVLFTWDLKTCRP-KAMPLNKDSA-N |
| XLogP | 1.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|