C12H15BrO4 — CID 166447063
methyl (3aR,5aR,6S,6aR,6bS)-6-bromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole-6-carboxylate (PubChem CID 166447063) has the molecular formula C12H15BrO4 and a molecular weight of 303.15 g/mol. Its IUPAC name is methyl (3aR,5aR,6S,6aR,6bS)-6-bromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole-6-carboxylate.
| Compound Name | methyl (3aR,5aR,6S,6aR,6bS)-6-bromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 166447063 |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | methyl (3aR,5aR,6S,6aR,6bS)-6-bromo-2,2-dimethyl-3a,5a,6a,6b-tetrahydrocyclopropa[g][1,3]benzodioxole-6-carboxylate |
| SMILES | COC(=O)[C@@]1(Br)[C@H]2[C@@H]3OC(C)(C)O[C@@H]3C=C[C@H]21 |
| InChI | InChI=1S/C12H15BrO4/c1-11(2)16-7-5-4-6-8(9(7)17-11)12(6,13)10(14)15-3/h4-9H,1-3H3/t6-,7-,8-,9-,12+/m1/s1 |
| InChIKey | SQFHQBJBUZAXRF-QFQOQTIOSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|