C30H27N3O2 — CID 143076269
3-ethyl-N-[(3-methoxyphenyl)methyl]-5-naphthalen-2-yl-2-phenylimidazole-4-carboxamide (PubChem CID 143076269) has the molecular formula C30H27N3O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 3-ethyl-N-[(3-methoxyphenyl)methyl]-5-naphthalen-2-yl-2-phenylimidazole-4-carboxamide.
| Compound Name | 3-ethyl-N-[(3-methoxyphenyl)methyl]-5-naphthalen-2-yl-2-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 143076269 |
| Molecular Formula | C30H27N3O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-ethyl-N-[(3-methoxyphenyl)methyl]-5-naphthalen-2-yl-2-phenylimidazole-4-carboxamide |
| SMILES | CCn1c(-c2ccccc2)nc(-c2ccc3ccccc3c2)c1C(=O)NCc1cccc(OC)c1 |
| InChI | InChI=1S/C30H27N3O2/c1-3-33-28(30(34)31-20-21-10-9-15-26(18-21)35-2)27(32-29(33)23-12-5-4-6-13-23)25-17-16-22-11-7-8-14-24(22)19-25/h4-19H,3,20H2,1-2H3,(H,31,34) |
| InChIKey | HKAZSSBCITVDSK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |