C12H17NS2 — CID 143076305
(Z)-2-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-1,3,5-trien-2-yl]sulfanylbut-2-ene-1-thiol (PubChem CID 143076305) has the molecular formula C12H17NS2 and a molecular weight of 239.41 g/mol. Its IUPAC name is (Z)-2-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-1,3,5-trien-2-yl]sulfanylbut-2-ene-1-thiol.
| Compound Name | (Z)-2-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-1,3,5-trien-2-yl]sulfanylbut-2-ene-1-thiol |
|---|---|
| PubChem CID | 143076305 |
| Molecular Formula | C12H17NS2 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (Z)-2-[(3E,5Z)-3-methyl-6-(methylideneamino)hexa-1,3,5-trien-2-yl]sulfanylbut-2-ene-1-thiol |
| SMILES | C=N/C=C\C=C(/C)C(=C)S/C(=C\C)CS |
| InChI | InChI=1S/C12H17NS2/c1-5-12(9-14)15-11(3)10(2)7-6-8-13-4/h5-8,14H,3-4,9H2,1-2H3/b8-6-,10-7+,12-5- |
| InChIKey | JQDCTPUEMMHJTM-LUQDGNOOSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|