C19H31NS2 — CID 177001399
ethane;(3Z)-4-(ethylideneamino)buta-1,3-diene-2-thiol;(2E,3Z)-3-ethylidene-2-prop-2-enylidenethiophene (PubChem CID 177001399) has the molecular formula C19H31NS2 and a molecular weight of 337.60 g/mol. Its IUPAC name is ethane;(3Z)-4-(ethylideneamino)buta-1,3-diene-2-thiol;(2E,3Z)-3-ethylidene-2-prop-2-enylidenethiophene.
| Compound Name | ethane;(3Z)-4-(ethylideneamino)buta-1,3-diene-2-thiol;(2E,3Z)-3-ethylidene-2-prop-2-enylidenethiophene |
|---|---|
| PubChem CID | 177001399 |
| Molecular Formula | C19H31NS2 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethane;(3Z)-4-(ethylideneamino)buta-1,3-diene-2-thiol;(2E,3Z)-3-ethylidene-2-prop-2-enylidenethiophene |
| SMILES | C=C(S)/C=C\N=C\C.C=C/C=c1/scc/c1=C/C.CC.CC |
| InChI | InChI=1S/C9H10S.C6H9NS.2C2H6/c1-3-5-9-8(4-2)6-7-10-9;1-3-7-5-4-6(2)8;2*1-2/h3-7H,1H2,2H3;3-5,8H,2H2,1H3;2*1-2H3/b8-4-,9-5+;5-4-,7-3+;; |
| InChIKey | KTFYXPNAEGTSRD-UDRRQXNUSA-N |
| XLogP | 5.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|