About acetylene;2-chloro-5-ethylfuran;2-methylpropane
acetylene;2-chloro-5-ethylfuran;2-methylpropane (PubChem CID 143076858) has the molecular formula C12H19ClO
and a molecular weight of 214.74 g/mol. Its IUPAC name is acetylene;2-chloro-5-ethylfuran;2-methylpropane.
Molecular Properties
| Compound Name | acetylene;2-chloro-5-ethylfuran;2-methylpropane |
| PubChem CID | 143076858 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | acetylene;2-chloro-5-ethylfuran;2-methylpropane |
| SMILES | C#C.CC(C)C.CCc1ccc(Cl)o1 |
| InChI | InChI=1S/C6H7ClO.C4H10.C2H2/c1-2-5-3-4-6(7)8-5;1-4(2)3;1-2/h3-4H,2H2,1H3;4H,1-3H3;1-2H |
| InChIKey | XDCBARNGEDXWEG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-chloro-5-ethylfuran;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-chloro-5-ethylfuran;2-methylpropane?
The IUPAC name of acetylene;2-chloro-5-ethylfuran;2-methylpropane (CID 143076858) is acetylene;2-chloro-5-ethylfuran;2-methylpropane.
What is the SMILES notation for acetylene;2-chloro-5-ethylfuran;2-methylpropane?
The canonical SMILES for acetylene;2-chloro-5-ethylfuran;2-methylpropane is C#C.CC(C)C.CCc1ccc(Cl)o1.
What is the InChIKey of acetylene;2-chloro-5-ethylfuran;2-methylpropane?
The InChIKey is XDCBARNGEDXWEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO.C4H10.C2H2/c1-2-5-3-4-6(7)8-5;1-4(2)3;1-2/h3-4H,2H2,1H3;4H,1-3H3;1-2H.
What are the key properties of acetylene;2-chloro-5-ethylfuran;2-methylpropane?
acetylene;2-chloro-5-ethylfuran;2-methylpropane has a molecular weight of 214.74 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-chloro-5-ethylfuran;2-methylpropane is sourced from PubChem (CID 143076858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).