C13H24O2 — CID 143077184
(Z)-2,2-dimethyl-5-prop-1-en-2-yloxyoct-5-en-4-ol (PubChem CID 143077184) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (Z)-2,2-dimethyl-5-prop-1-en-2-yloxyoct-5-en-4-ol.
| Compound Name | (Z)-2,2-dimethyl-5-prop-1-en-2-yloxyoct-5-en-4-ol |
|---|---|
| PubChem CID | 143077184 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (Z)-2,2-dimethyl-5-prop-1-en-2-yloxyoct-5-en-4-ol |
| SMILES | C=C(C)O/C(=C\CC)C(O)CC(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-7-8-12(15-10(2)3)11(14)9-13(4,5)6/h8,11,14H,2,7,9H2,1,3-6H3/b12-8- |
| InChIKey | PULBMEGDTSVGQO-WQLSENKSSA-N |
| XLogP | 3.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|